About butanoate;(4-iodophenyl)-diphenylsulfanium
butanoate;(4-iodophenyl)-diphenylsulfanium (PubChem CID 161461983) has the molecular formula C22H21IO2S
and a molecular weight of 476.38 g/mol. Its IUPAC name is butanoate;(4-iodophenyl)-diphenylsulfanium.
Molecular Properties
| Compound Name | butanoate;(4-iodophenyl)-diphenylsulfanium |
| PubChem CID | 161461983 |
| Molecular Formula | C22H21IO2S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | butanoate;(4-iodophenyl)-diphenylsulfanium |
| SMILES | CCCC(=O)[O-].Ic1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H14IS.C4H8O2/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;1-2-3-4(5)6/h1-14H;2-3H2,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | WBXZEVCAZOFYPL-UHFFFAOYSA-M |
| XLogP | 4.92 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze butanoate;(4-iodophenyl)-diphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;(4-iodophenyl)-diphenylsulfanium?
The IUPAC name of butanoate;(4-iodophenyl)-diphenylsulfanium (CID 161461983) is butanoate;(4-iodophenyl)-diphenylsulfanium.
What is the SMILES notation for butanoate;(4-iodophenyl)-diphenylsulfanium?
The canonical SMILES for butanoate;(4-iodophenyl)-diphenylsulfanium is CCCC(=O)[O-].Ic1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of butanoate;(4-iodophenyl)-diphenylsulfanium?
The InChIKey is WBXZEVCAZOFYPL-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H14IS.C4H8O2/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;1-2-3-4(5)6/h1-14H;2-3H2,1H3,(H,5,6)/q+1;/p-1.
What are the key properties of butanoate;(4-iodophenyl)-diphenylsulfanium?
butanoate;(4-iodophenyl)-diphenylsulfanium has a molecular weight of 476.38 g/mol, XLogP of 4.92, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;(4-iodophenyl)-diphenylsulfanium is sourced from PubChem (CID 161461983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).