About butanoate;ytterbium(2+)
butanoate;ytterbium(2+) (PubChem CID 88777454) has the molecular formula C8H14O4Yb
and a molecular weight of 347.24 g/mol. Its IUPAC name is butanoate;ytterbium(2+).
Molecular Properties
| Compound Name | butanoate;ytterbium(2+) |
| PubChem CID | 88777454 |
| Molecular Formula | C8H14O4Yb |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | butanoate;ytterbium(2+) |
| SMILES | CCCC(=O)[O-].CCCC(=O)[O-].[Yb+2] |
| InChI | InChI=1S/2C4H8O2.Yb/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | POCXCGAPXMEVBB-UHFFFAOYSA-L |
| XLogP | -0.93 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butanoate;ytterbium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;ytterbium(2+)?
The IUPAC name of butanoate;ytterbium(2+) (CID 88777454) is butanoate;ytterbium(2+).
What is the SMILES notation for butanoate;ytterbium(2+)?
The canonical SMILES for butanoate;ytterbium(2+) is CCCC(=O)[O-].CCCC(=O)[O-].[Yb+2].
What is the InChIKey of butanoate;ytterbium(2+)?
The InChIKey is POCXCGAPXMEVBB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H8O2.Yb/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2.
What are the key properties of butanoate;ytterbium(2+)?
butanoate;ytterbium(2+) has a molecular weight of 347.24 g/mol, XLogP of -0.93, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;ytterbium(2+) is sourced from PubChem (CID 88777454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).