About potassium butanoate
potassium butanoate (PubChem CID 23677461) has the molecular formula C4H7KO2
and a molecular weight of 126.20 g/mol. Its IUPAC name is potassium butanoate.
Molecular Properties
| Compound Name | potassium butanoate |
| PubChem CID | 23677461 |
| Molecular Formula | C4H7KO2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | potassium butanoate |
| SMILES | CCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C4H8O2.K/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | RWMKSKOZLCXHOK-UHFFFAOYSA-M |
| XLogP | -3.46 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium butanoate?
The IUPAC name of potassium butanoate (CID 23677461) is potassium butanoate.
What is the SMILES notation for potassium butanoate?
The canonical SMILES for potassium butanoate is CCCC(=O)[O-].[K+].
What is the InChIKey of potassium butanoate?
The InChIKey is RWMKSKOZLCXHOK-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O2.K/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1.
What are the key properties of potassium butanoate?
potassium butanoate has a molecular weight of 126.20 g/mol, XLogP of -3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium butanoate is sourced from PubChem (CID 23677461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).