About butanoate;titanium(2+);acetate
butanoate;titanium(2+);acetate (PubChem CID 87845450) has the molecular formula C6H10O4Ti
and a molecular weight of 194.01 g/mol. Its IUPAC name is butanoate;titanium(2+);acetate.
Molecular Properties
| Compound Name | butanoate;titanium(2+);acetate |
| PubChem CID | 87845450 |
| Molecular Formula | C6H10O4Ti |
| Molecular Weight | 194.01 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | butanoate;titanium(2+);acetate |
| SMILES | CC(=O)[O-].CCCC(=O)[O-].[Ti+2] |
| InChI | InChI=1S/C4H8O2.C2H4O2.Ti/c1-2-3-4(5)6;1-2(3)4;/h2-3H2,1H3,(H,5,6);1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | OWUPFSVSTGZWFK-UHFFFAOYSA-L |
| XLogP | -1.71 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.01 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butanoate;titanium(2+);acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;titanium(2+);acetate?
The IUPAC name of butanoate;titanium(2+);acetate (CID 87845450) is butanoate;titanium(2+);acetate.
What is the SMILES notation for butanoate;titanium(2+);acetate?
The canonical SMILES for butanoate;titanium(2+);acetate is CC(=O)[O-].CCCC(=O)[O-].[Ti+2].
What is the InChIKey of butanoate;titanium(2+);acetate?
The InChIKey is OWUPFSVSTGZWFK-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H8O2.C2H4O2.Ti/c1-2-3-4(5)6;1-2(3)4;/h2-3H2,1H3,(H,5,6);1H3,(H,3,4);/q;;+2/p-2.
What are the key properties of butanoate;titanium(2+);acetate?
butanoate;titanium(2+);acetate has a molecular weight of 194.01 g/mol, XLogP of -1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;titanium(2+);acetate is sourced from PubChem (CID 87845450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).