About silver butanoate
silver butanoate (PubChem CID 14944495) has the molecular formula C4H7AgO2
and a molecular weight of 194.97 g/mol. Its IUPAC name is silver butanoate.
Molecular Properties
| Compound Name | silver butanoate |
| PubChem CID | 14944495 |
| Molecular Formula | C4H7AgO2 |
| Molecular Weight | 194.97 g/mol |
| Exact Mass | 193.95 |
| IUPAC Name | silver butanoate |
| SMILES | CCCC(=O)[O-].[Ag+] |
| InChI | InChI=1S/C4H8O2.Ag/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | JKOCEVIXVMBKJA-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.97 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze silver butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver butanoate?
The IUPAC name of silver butanoate (CID 14944495) is silver butanoate.
What is the SMILES notation for silver butanoate?
The canonical SMILES for silver butanoate is CCCC(=O)[O-].[Ag+].
What is the InChIKey of silver butanoate?
The InChIKey is JKOCEVIXVMBKJA-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O2.Ag/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1.
What are the key properties of silver butanoate?
silver butanoate has a molecular weight of 194.97 g/mol, XLogP of -0.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver butanoate is sourced from PubChem (CID 14944495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).