About disodium;butanoate;hydroxide
disodium;butanoate;hydroxide (PubChem CID 173219323) has the molecular formula C4H8Na2O3
and a molecular weight of 150.08 g/mol. Its IUPAC name is disodium;butanoate;hydroxide.
Molecular Properties
| Compound Name | disodium;butanoate;hydroxide |
| PubChem CID | 173219323 |
| Molecular Formula | C4H8Na2O3 |
| Molecular Weight | 150.08 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | disodium;butanoate;hydroxide |
| SMILES | CCCC(=O)[O-].[Na+].[Na+].[OH-] |
| InChI | InChI=1S/C4H8O2.2Na.H2O/c1-2-3-4(5)6;;;/h2-3H2,1H3,(H,5,6);;;1H2/q;2*+1;/p-2 |
| InChIKey | HQLHMDNSKKBZLS-UHFFFAOYSA-L |
| XLogP | -6.63 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.08 |
| LogP ≤ 5 | -6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze disodium;butanoate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;butanoate;hydroxide?
The IUPAC name of disodium;butanoate;hydroxide (CID 173219323) is disodium;butanoate;hydroxide.
What is the SMILES notation for disodium;butanoate;hydroxide?
The canonical SMILES for disodium;butanoate;hydroxide is CCCC(=O)[O-].[Na+].[Na+].[OH-].
What is the InChIKey of disodium;butanoate;hydroxide?
The InChIKey is HQLHMDNSKKBZLS-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H8O2.2Na.H2O/c1-2-3-4(5)6;;;/h2-3H2,1H3,(H,5,6);;;1H2/q;2*+1;/p-2.
What are the key properties of disodium;butanoate;hydroxide?
disodium;butanoate;hydroxide has a molecular weight of 150.08 g/mol, XLogP of -6.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;butanoate;hydroxide is sourced from PubChem (CID 173219323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).