About sodium;benzene;butanoate
sodium;benzene;butanoate (PubChem CID 160864894) has the molecular formula C10H13NaO2
and a molecular weight of 188.20 g/mol. Its IUPAC name is sodium;benzene;butanoate.
Molecular Properties
| Compound Name | sodium;benzene;butanoate |
| PubChem CID | 160864894 |
| Molecular Formula | C10H13NaO2 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | sodium;benzene;butanoate |
| SMILES | CCCC(=O)[O-].[Na+].c1ccccc1 |
| InChI | InChI=1S/C6H6.C4H8O2.Na/c1-2-4-6-5-3-1;1-2-3-4(5)6;/h1-6H;2-3H2,1H3,(H,5,6);/q;;+1/p-1 |
| InChIKey | ZLQWZHNEQSTMBA-UHFFFAOYSA-M |
| XLogP | -1.77 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;benzene;butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzene;butanoate?
The IUPAC name of sodium;benzene;butanoate (CID 160864894) is sodium;benzene;butanoate.
What is the SMILES notation for sodium;benzene;butanoate?
The canonical SMILES for sodium;benzene;butanoate is CCCC(=O)[O-].[Na+].c1ccccc1.
What is the InChIKey of sodium;benzene;butanoate?
The InChIKey is ZLQWZHNEQSTMBA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6.C4H8O2.Na/c1-2-4-6-5-3-1;1-2-3-4(5)6;/h1-6H;2-3H2,1H3,(H,5,6);/q;;+1/p-1.
What are the key properties of sodium;benzene;butanoate?
sodium;benzene;butanoate has a molecular weight of 188.20 g/mol, XLogP of -1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzene;butanoate is sourced from PubChem (CID 160864894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).