About strontium butanoate
strontium butanoate (PubChem CID 19035288) has the molecular formula C8H14O4Sr
and a molecular weight of 261.82 g/mol. Its IUPAC name is strontium butanoate.
Molecular Properties
| Compound Name | strontium butanoate |
| PubChem CID | 19035288 |
| Molecular Formula | C8H14O4Sr |
| Molecular Weight | 261.82 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | strontium butanoate |
| SMILES | CCCC(=O)[O-].CCCC(=O)[O-].[Sr+2] |
| InChI | InChI=1S/2C4H8O2.Sr/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | ITUCOQTVTSFGRJ-UHFFFAOYSA-L |
| XLogP | -1.31 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.82 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze strontium butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium butanoate?
The IUPAC name of strontium butanoate (CID 19035288) is strontium butanoate.
What is the SMILES notation for strontium butanoate?
The canonical SMILES for strontium butanoate is CCCC(=O)[O-].CCCC(=O)[O-].[Sr+2].
What is the InChIKey of strontium butanoate?
The InChIKey is ITUCOQTVTSFGRJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H8O2.Sr/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2.
What are the key properties of strontium butanoate?
strontium butanoate has a molecular weight of 261.82 g/mol, XLogP of -1.31, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for strontium butanoate is sourced from PubChem (CID 19035288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).