About magnesium butanoate
magnesium butanoate (PubChem CID 6453218) has the molecular formula C8H14MgO4
and a molecular weight of 198.50 g/mol. Its IUPAC name is magnesium butanoate.
Molecular Properties
| Compound Name | magnesium butanoate |
| PubChem CID | 6453218 |
| Molecular Formula | C8H14MgO4 |
| Molecular Weight | 198.50 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | magnesium butanoate |
| SMILES | CCCC(=O)[O-].CCCC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C4H8O2.Mg/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | XGIJWNPXLLJTTB-UHFFFAOYSA-L |
| XLogP | -1.31 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.50 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze magnesium butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium butanoate?
The IUPAC name of magnesium butanoate (CID 6453218) is magnesium butanoate.
What is the SMILES notation for magnesium butanoate?
The canonical SMILES for magnesium butanoate is CCCC(=O)[O-].CCCC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium butanoate?
The InChIKey is XGIJWNPXLLJTTB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H8O2.Mg/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2.
What are the key properties of magnesium butanoate?
magnesium butanoate has a molecular weight of 198.50 g/mol, XLogP of -1.31, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium butanoate is sourced from PubChem (CID 6453218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).