About dimagnesium;butanoate;propanoate
dimagnesium;butanoate;propanoate (PubChem CID 19914218) has the molecular formula C7H12Mg2O4+2
and a molecular weight of 208.78 g/mol. Its IUPAC name is dimagnesium;butanoate;propanoate.
Molecular Properties
| Compound Name | dimagnesium;butanoate;propanoate |
| PubChem CID | 19914218 |
| Molecular Formula | C7H12Mg2O4+2 |
| Molecular Weight | 208.78 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | dimagnesium;butanoate;propanoate |
| SMILES | CCC(=O)[O-].CCCC(=O)[O-].[Mg+2].[Mg+2] |
| InChI | InChI=1S/C4H8O2.C3H6O2.2Mg/c1-2-3-4(5)6;1-2-3(4)5;;/h2-3H2,1H3,(H,5,6);2H2,1H3,(H,4,5);;/q;;2*+2/p-2 |
| InChIKey | AULJYAWMNMFJDV-UHFFFAOYSA-L |
| XLogP | -2.08 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.78 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimagnesium;butanoate;propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimagnesium;butanoate;propanoate?
The IUPAC name of dimagnesium;butanoate;propanoate (CID 19914218) is dimagnesium;butanoate;propanoate.
What is the SMILES notation for dimagnesium;butanoate;propanoate?
The canonical SMILES for dimagnesium;butanoate;propanoate is CCC(=O)[O-].CCCC(=O)[O-].[Mg+2].[Mg+2].
What is the InChIKey of dimagnesium;butanoate;propanoate?
The InChIKey is AULJYAWMNMFJDV-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H8O2.C3H6O2.2Mg/c1-2-3-4(5)6;1-2-3(4)5;;/h2-3H2,1H3,(H,5,6);2H2,1H3,(H,4,5);;/q;;2*+2/p-2.
What are the key properties of dimagnesium;butanoate;propanoate?
dimagnesium;butanoate;propanoate has a molecular weight of 208.78 g/mol, XLogP of -2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimagnesium;butanoate;propanoate is sourced from PubChem (CID 19914218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).