About butanoate;hafnium(4+);trihydroxide
butanoate;hafnium(4+);trihydroxide (PubChem CID 159888160) has the molecular formula C4H10HfO5
and a molecular weight of 316.61 g/mol. Its IUPAC name is butanoate;hafnium(4+);trihydroxide.
Molecular Properties
| Compound Name | butanoate;hafnium(4+);trihydroxide |
| PubChem CID | 159888160 |
| Molecular Formula | C4H10HfO5 |
| Molecular Weight | 316.61 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | butanoate;hafnium(4+);trihydroxide |
| SMILES | CCCC(=O)[O-].[Hf+4].[OH-].[OH-].[OH-] |
| InChI | InChI=1S/C4H8O2.Hf.3H2O/c1-2-3-4(5)6;;;;/h2-3H2,1H3,(H,5,6);;3*1H2/q;+4;;;/p-4 |
| InChIKey | NUKCDSLDNDJFFV-UHFFFAOYSA-J |
| XLogP | -1.00 |
| TPSA | 130.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.61 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze butanoate;hafnium(4+);trihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;hafnium(4+);trihydroxide?
The IUPAC name of butanoate;hafnium(4+);trihydroxide (CID 159888160) is butanoate;hafnium(4+);trihydroxide.
What is the SMILES notation for butanoate;hafnium(4+);trihydroxide?
The canonical SMILES for butanoate;hafnium(4+);trihydroxide is CCCC(=O)[O-].[Hf+4].[OH-].[OH-].[OH-].
What is the InChIKey of butanoate;hafnium(4+);trihydroxide?
The InChIKey is NUKCDSLDNDJFFV-UHFFFAOYSA-J. The full InChI is InChI=1S/C4H8O2.Hf.3H2O/c1-2-3-4(5)6;;;;/h2-3H2,1H3,(H,5,6);;3*1H2/q;+4;;;/p-4.
What are the key properties of butanoate;hafnium(4+);trihydroxide?
butanoate;hafnium(4+);trihydroxide has a molecular weight of 316.61 g/mol, XLogP of -1.00, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;hafnium(4+);trihydroxide is sourced from PubChem (CID 159888160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).