About (4-fluorophenyl)-diphenylsulfanium;propanoate
(4-fluorophenyl)-diphenylsulfanium;propanoate (PubChem CID 159057475) has the molecular formula C21H19FO2S
and a molecular weight of 354.45 g/mol. Its IUPAC name is (4-fluorophenyl)-diphenylsulfanium;propanoate.
Molecular Properties
| Compound Name | (4-fluorophenyl)-diphenylsulfanium;propanoate |
| PubChem CID | 159057475 |
| Molecular Formula | C21H19FO2S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (4-fluorophenyl)-diphenylsulfanium;propanoate |
| SMILES | CCC(=O)[O-].Fc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H14FS.C3H6O2/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;1-2-3(4)5/h1-14H;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | JYARGTQWXHAAPK-UHFFFAOYSA-M |
| XLogP | 4.07 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)-diphenylsulfanium;propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)-diphenylsulfanium;propanoate?
The IUPAC name of (4-fluorophenyl)-diphenylsulfanium;propanoate (CID 159057475) is (4-fluorophenyl)-diphenylsulfanium;propanoate.
What is the SMILES notation for (4-fluorophenyl)-diphenylsulfanium;propanoate?
The canonical SMILES for (4-fluorophenyl)-diphenylsulfanium;propanoate is CCC(=O)[O-].Fc1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (4-fluorophenyl)-diphenylsulfanium;propanoate?
The InChIKey is JYARGTQWXHAAPK-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H14FS.C3H6O2/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;1-2-3(4)5/h1-14H;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of (4-fluorophenyl)-diphenylsulfanium;propanoate?
(4-fluorophenyl)-diphenylsulfanium;propanoate has a molecular weight of 354.45 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)-diphenylsulfanium;propanoate is sourced from PubChem (CID 159057475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).