C22H19F3O2S — CID 172792663
bis(4-methylphenyl)-phenylsulfanium;2,2,2-trifluoroacetate (PubChem CID 172792663) has the molecular formula C22H19F3O2S and a molecular weight of 404.45 g/mol. Its IUPAC name is bis(4-methylphenyl)-phenylsulfanium;2,2,2-trifluoroacetate.
| Compound Name | bis(4-methylphenyl)-phenylsulfanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 172792663 |
| Molecular Formula | C22H19F3O2S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | bis(4-methylphenyl)-phenylsulfanium;2,2,2-trifluoroacetate |
| SMILES | Cc1ccc([S+](c2ccccc2)c2ccc(C)cc2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C20H19S.C2HF3O2/c1-16-8-12-19(13-9-16)21(18-6-4-3-5-7-18)20-14-10-17(2)11-15-20;3-2(4,5)1(6)7/h3-15H,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | PTYUWFJHVPNGDI-UHFFFAOYSA-M |
| XLogP | 4.70 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|