C24H17F3O2S2 — CID 87247828
bicyclo[2.2.0]hexa-1,3,5-triene;diphenyl(thiophen-2-yl)sulfanium;2,2,2-trifluoroacetate (PubChem CID 87247828) has the molecular formula C24H17F3O2S2 and a molecular weight of 458.53 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;diphenyl(thiophen-2-yl)sulfanium;2,2,2-trifluoroacetate.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;diphenyl(thiophen-2-yl)sulfanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87247828 |
| Molecular Formula | C24H17F3O2S2 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;diphenyl(thiophen-2-yl)sulfanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.c1cc2ccc1-2.c1ccc([S+](c2ccccc2)c2cccs2)cc1 |
| InChI | InChI=1S/C16H13S2.C6H4.C2HF3O2/c1-3-8-14(9-4-1)18(16-12-7-13-17-16)15-10-5-2-6-11-15;1-2-6-4-3-5(1)6;3-2(4,5)1(6)7/h1-13H;1-4H;(H,6,7)/q+1;;/p-1 |
| InChIKey | ZTLNUWGCPIWJAW-UHFFFAOYSA-M |
| XLogP | 5.81 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|