C8H8F3O2P — CID 162300055
phenylphosphanium;2,2,2-trifluoroacetate (PubChem CID 162300055) has the molecular formula C8H8F3O2P and a molecular weight of 224.12 g/mol. Its IUPAC name is phenylphosphanium;2,2,2-trifluoroacetate.
| Compound Name | phenylphosphanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162300055 |
| Molecular Formula | C8H8F3O2P |
| Molecular Weight | 224.12 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | phenylphosphanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[PH3+]c1ccccc1 |
| InChI | InChI=1S/C6H7P.C2HF3O2/c7-6-4-2-1-3-5-6;3-2(4,5)1(6)7/h1-5H,7H2;(H,6,7) |
| InChIKey | PAXSAIRILAEGHW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.12 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|