C12H15F3N2O3 — CID 11087600
[2-oxo-2-(2-phenylethylamino)ethyl]azanium;2,2,2-trifluoroacetate (PubChem CID 11087600) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylethylamino)ethyl]azanium;2,2,2-trifluoroacetate.
| Compound Name | [2-oxo-2-(2-phenylethylamino)ethyl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11087600 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | [2-oxo-2-(2-phenylethylamino)ethyl]azanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[NH3+]CC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C10H14N2O.C2HF3O2/c11-8-10(13)12-7-6-9-4-2-1-3-5-9;3-2(4,5)1(6)7/h1-5H,6-8,11H2,(H,12,13);(H,6,7) |
| InChIKey | MLHCSVHLWZQJRR-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |