C12H14NNaO3S — CID 155944067
sodium 2-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanylacetate (PubChem CID 155944067) has the molecular formula C12H14NNaO3S and a molecular weight of 275.31 g/mol. Its IUPAC name is sodium 2-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanylacetate.
| Compound Name | sodium 2-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanylacetate |
|---|---|
| PubChem CID | 155944067 |
| Molecular Formula | C12H14NNaO3S |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | sodium 2-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanylacetate |
| SMILES | O=C([O-])CSCC(=O)NCCc1ccccc1.[Na+] |
| InChI | InChI=1S/C12H15NO3S.Na/c14-11(8-17-9-12(15)16)13-7-6-10-4-2-1-3-5-10;/h1-5H,6-9H2,(H,13,14)(H,15,16);/q;+1/p-1 |
| InChIKey | RYEWRYZMWYSNON-UHFFFAOYSA-M |
| XLogP | -3.17 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |