About molecular hydrogen;2-phenylethylcarbamic acid
molecular hydrogen;2-phenylethylcarbamic acid (PubChem CID 145072858) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is molecular hydrogen;2-phenylethylcarbamic acid.
Molecular Properties
| Compound Name | molecular hydrogen;2-phenylethylcarbamic acid |
| PubChem CID | 145072858 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | molecular hydrogen;2-phenylethylcarbamic acid |
| SMILES | O=C(O)NCCc1ccccc1.[H][H] |
| InChI | InChI=1S/C9H11NO2.H2/c11-9(12)10-7-6-8-4-2-1-3-5-8;/h1-5,10H,6-7H2,(H,11,12);1H |
| InChIKey | WDBCEXCRZTZZCG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze molecular hydrogen;2-phenylethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;2-phenylethylcarbamic acid?
The IUPAC name of molecular hydrogen;2-phenylethylcarbamic acid (CID 145072858) is molecular hydrogen;2-phenylethylcarbamic acid.
What is the SMILES notation for molecular hydrogen;2-phenylethylcarbamic acid?
The canonical SMILES for molecular hydrogen;2-phenylethylcarbamic acid is O=C(O)NCCc1ccccc1.[H][H].
What is the InChIKey of molecular hydrogen;2-phenylethylcarbamic acid?
The InChIKey is WDBCEXCRZTZZCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.H2/c11-9(12)10-7-6-8-4-2-1-3-5-8;/h1-5,10H,6-7H2,(H,11,12);1H.
What are the key properties of molecular hydrogen;2-phenylethylcarbamic acid?
molecular hydrogen;2-phenylethylcarbamic acid has a molecular weight of 167.21 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;2-phenylethylcarbamic acid is sourced from PubChem (CID 145072858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).