C10H13NO — CID 16656655
2,2,2-trideuterio-N-(2-phenylethyl)acetamide (PubChem CID 16656655) has the molecular formula C10H13NO and a molecular weight of 166.24 g/mol. Its IUPAC name is 2,2,2-trideuterio-N-(2-phenylethyl)acetamide.
| Compound Name | 2,2,2-trideuterio-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 16656655 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 2,2,2-trideuterio-N-(2-phenylethyl)acetamide |
| SMILES | [2H]C([2H])([2H])C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C10H13NO/c1-9(12)11-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,11,12)/i1D3 |
| InChIKey | MODKMHXGCGKTLE-FIBGUPNXSA-N |
| XLogP | 1.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |