C24H24N2O2 — CID 984633
1-N,4-N-bis(2-phenylethyl)benzene-1,4-dicarboxamide (PubChem CID 984633) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-N,4-N-bis(2-phenylethyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(2-phenylethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 984633 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-N,4-N-bis(2-phenylethyl)benzene-1,4-dicarboxamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc(C(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O2/c27-23(25-17-15-19-7-3-1-4-8-19)21-11-13-22(14-12-21)24(28)26-18-16-20-9-5-2-6-10-20/h1-14H,15-18H2,(H,25,27)(H,26,28) |
| InChIKey | VWAFRDYPCCQYFC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |