C14H14N2O2 — CID 2090847
6-oxo-N-(2-phenylethyl)-1H-pyridine-3-carboxamide (PubChem CID 2090847) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 6-oxo-N-(2-phenylethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 6-oxo-N-(2-phenylethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2090847 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 6-oxo-N-(2-phenylethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C14H14N2O2/c17-13-7-6-12(10-16-13)14(18)15-9-8-11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,15,18)(H,16,17) |
| InChIKey | MUXBDEHEXHLDJR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |