C15H16N2O2S — CID 17406782
N-(2-benzylsulfanylethyl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 17406782) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-benzylsulfanylethyl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 17406782 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCSCc1ccccc1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C15H16N2O2S/c18-14-7-6-13(10-17-14)15(19)16-8-9-20-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H,16,19)(H,17,18) |
| InChIKey | USKYOWALDIFESZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|