C8H10N2O3 — CID 43389064
N-(2-hydroxyethyl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 43389064) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43389064 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | N-(2-hydroxyethyl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCO)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C8H10N2O3/c11-4-3-9-8(13)6-1-2-7(12)10-5-6/h1-2,5,11H,3-4H2,(H,9,13)(H,10,12) |
| InChIKey | JGFYAAIVZRHCPU-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |