C9H12N2O4 — CID 66176023
N-(2,3-dihydroxypropyl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 66176023) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66176023 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCC(O)CO)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C9H12N2O4/c12-5-7(13)4-11-9(15)6-1-2-8(14)10-3-6/h1-3,7,12-13H,4-5H2,(H,10,14)(H,11,15) |
| InChIKey | SNMAGMSMTMLHSC-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |