C6H7N3O2 — CID 11051863
6-oxo-1H-pyridine-3-carbohydrazide (PubChem CID 11051863) has the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. Its IUPAC name is 6-oxo-1H-pyridine-3-carbohydrazide.
| Compound Name | 6-oxo-1H-pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 11051863 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 6-oxo-1H-pyridine-3-carbohydrazide |
| SMILES | NNC(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C6H7N3O2/c7-9-6(11)4-1-2-5(10)8-3-4/h1-3H,7H2,(H,8,10)(H,9,11) |
| InChIKey | CWZHFIGWRBBYJC-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|