C18H22N4O5S — CID 118335380
6-oxo-N-[5-[(4-sulfamoylbenzoyl)amino]pentyl]-1H-pyridine-3-carboxamide (PubChem CID 118335380) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is 6-oxo-N-[5-[(4-sulfamoylbenzoyl)amino]pentyl]-1H-pyridine-3-carboxamide.
| Compound Name | 6-oxo-N-[5-[(4-sulfamoylbenzoyl)amino]pentyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118335380 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 6-oxo-N-[5-[(4-sulfamoylbenzoyl)amino]pentyl]-1H-pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCCCCCNC(=O)c2ccc(=O)[nH]c2)cc1 |
| InChI | InChI=1S/C18H22N4O5S/c19-28(26,27)15-7-4-13(5-8-15)17(24)20-10-2-1-3-11-21-18(25)14-6-9-16(23)22-12-14/h4-9,12H,1-3,10-11H2,(H,20,24)(H,21,25)(H,22,23)(H2,19,26,27) |
| InChIKey | XHDRDLQBXHGZKX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 151.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|