C15H25N2O7PS — CID 165163701
methyl 7-[(4-sulfamoylbenzoyl)amino]heptyl hydrogen phosphate (PubChem CID 165163701) has the molecular formula C15H25N2O7PS and a molecular weight of 408.41 g/mol. Its IUPAC name is methyl 7-[(4-sulfamoylbenzoyl)amino]heptyl hydrogen phosphate.
| Compound Name | methyl 7-[(4-sulfamoylbenzoyl)amino]heptyl hydrogen phosphate |
|---|---|
| PubChem CID | 165163701 |
| Molecular Formula | C15H25N2O7PS |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | methyl 7-[(4-sulfamoylbenzoyl)amino]heptyl hydrogen phosphate |
| SMILES | COP(=O)(O)OCCCCCCCNC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H25N2O7PS/c1-23-25(19,20)24-12-6-4-2-3-5-11-17-15(18)13-7-9-14(10-8-13)26(16,21)22/h7-10H,2-6,11-12H2,1H3,(H,17,18)(H,19,20)(H2,16,21,22) |
| InChIKey | IDNIIGUKYDYDAW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|