C16H29N3O3S — CID 68609461
N-ethylbutan-1-amine;N-propyl-4-sulfamoylbenzamide (PubChem CID 68609461) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is N-ethylbutan-1-amine;N-propyl-4-sulfamoylbenzamide.
| Compound Name | N-ethylbutan-1-amine;N-propyl-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 68609461 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-ethylbutan-1-amine;N-propyl-4-sulfamoylbenzamide |
| SMILES | CCCCNCC.CCCNC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H14N2O3S.C6H15N/c1-2-7-12-10(13)8-3-5-9(6-4-8)16(11,14)15;1-3-5-6-7-4-2/h3-6H,2,7H2,1H3,(H,12,13)(H2,11,14,15);7H,3-6H2,1-2H3 |
| InChIKey | ZPMHJGUNEYHFDU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|