C11H19N3O3S — CID 68596264
N-ethyl-4-sulfamoylbenzamide;N-methylmethanamine (PubChem CID 68596264) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-ethyl-4-sulfamoylbenzamide;N-methylmethanamine.
| Compound Name | N-ethyl-4-sulfamoylbenzamide;N-methylmethanamine |
|---|---|
| PubChem CID | 68596264 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-ethyl-4-sulfamoylbenzamide;N-methylmethanamine |
| SMILES | CCNC(=O)c1ccc(S(N)(=O)=O)cc1.CNC |
| InChI | InChI=1S/C9H12N2O3S.C2H7N/c1-2-11-9(12)7-3-5-8(6-4-7)15(10,13)14;1-3-2/h3-6H,2H2,1H3,(H,11,12)(H2,10,13,14);3H,1-2H3 |
| InChIKey | XFDLXCWHSSXAAL-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |