C10H11BrN2O3S — CID 47441752
N-(2-bromoprop-2-enyl)-4-sulfamoylbenzamide (PubChem CID 47441752) has the molecular formula C10H11BrN2O3S and a molecular weight of 319.18 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-4-sulfamoylbenzamide.
| Compound Name | N-(2-bromoprop-2-enyl)-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 47441752 |
| Molecular Formula | C10H11BrN2O3S |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-4-sulfamoylbenzamide |
| SMILES | C=C(Br)CNC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H11BrN2O3S/c1-7(11)6-13-10(14)8-2-4-9(5-3-8)17(12,15)16/h2-5H,1,6H2,(H,13,14)(H2,12,15,16) |
| InChIKey | AKJBTMJLEDPIDU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |