C10H14N3O4PS — CID 59991350
N-[2-oxo-2-(phosphanylmethylamino)ethyl]-4-sulfamoylbenzamide (PubChem CID 59991350) has the molecular formula C10H14N3O4PS and a molecular weight of 303.28 g/mol. Its IUPAC name is N-[2-oxo-2-(phosphanylmethylamino)ethyl]-4-sulfamoylbenzamide.
| Compound Name | N-[2-oxo-2-(phosphanylmethylamino)ethyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 59991350 |
| Molecular Formula | C10H14N3O4PS |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-[2-oxo-2-(phosphanylmethylamino)ethyl]-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCC(=O)NCP)cc1 |
| InChI | InChI=1S/C10H14N3O4PS/c11-19(16,17)8-3-1-7(2-4-8)10(15)12-5-9(14)13-6-18/h1-4H,5-6,18H2,(H,12,15)(H,13,14)(H2,11,16,17) |
| InChIKey | AZIUUXLLYOTPMY-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|