C8H12N2O3 — CID 66177691
N-(2,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide (PubChem CID 66177691) has the molecular formula C8H12N2O3 and a molecular weight of 184.20 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 66177691 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCC(O)CO)c1ccc[nH]1 |
| InChI | InChI=1S/C8H12N2O3/c11-5-6(12)4-10-8(13)7-2-1-3-9-7/h1-3,6,9,11-12H,4-5H2,(H,10,13) |
| InChIKey | ZMAXUPSNPLDXRB-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |