C10H13NO5 — CID 114344939
N-(2,3-dihydroxypropyl)-2,3-dihydroxybenzamide (PubChem CID 114344939) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2,3-dihydroxybenzamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114344939 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2,3-dihydroxybenzamide |
| SMILES | O=C(NCC(O)CO)c1cccc(O)c1O |
| InChI | InChI=1S/C10H13NO5/c12-5-6(13)4-11-10(16)7-2-1-3-8(14)9(7)15/h1-3,6,12-15H,4-5H2,(H,11,16) |
| InChIKey | PBWSEOOGOBCNSC-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|