C15H15NO5 — CID 66178018
8-(2,3-dihydroxypropylcarbamoyl)naphthalene-1-carboxylic acid (PubChem CID 66178018) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 8-(2,3-dihydroxypropylcarbamoyl)naphthalene-1-carboxylic acid.
| Compound Name | 8-(2,3-dihydroxypropylcarbamoyl)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 66178018 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 8-(2,3-dihydroxypropylcarbamoyl)naphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2cccc(C(=O)NCC(O)CO)c12 |
| InChI | InChI=1S/C15H15NO5/c17-8-10(18)7-16-14(19)11-5-1-3-9-4-2-6-12(13(9)11)15(20)21/h1-6,10,17-18H,7-8H2,(H,16,19)(H,20,21) |
| InChIKey | RWZSIVFKXJPBFB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |