C14H13NO6S — CID 87260631
8-(2-sulfoethylcarbamoyl)naphthalene-1-carboxylic acid (PubChem CID 87260631) has the molecular formula C14H13NO6S and a molecular weight of 323.33 g/mol. Its IUPAC name is 8-(2-sulfoethylcarbamoyl)naphthalene-1-carboxylic acid.
| Compound Name | 8-(2-sulfoethylcarbamoyl)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 87260631 |
| Molecular Formula | C14H13NO6S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 8-(2-sulfoethylcarbamoyl)naphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2cccc(C(=O)NCCS(=O)(=O)O)c12 |
| InChI | InChI=1S/C14H13NO6S/c16-13(15-7-8-22(19,20)21)10-5-1-3-9-4-2-6-11(12(9)10)14(17)18/h1-6H,7-8H2,(H,15,16)(H,17,18)(H,19,20,21) |
| InChIKey | MHUFEXNYVVJLOF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|