C10H10Br3NO6S2 — CID 23386760
2-[[2-(tribromomethylsulfonyl)benzoyl]amino]ethanesulfonic acid (PubChem CID 23386760) has the molecular formula C10H10Br3NO6S2 and a molecular weight of 544.04 g/mol. Its IUPAC name is 2-[[2-(tribromomethylsulfonyl)benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-(tribromomethylsulfonyl)benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 23386760 |
| Molecular Formula | C10H10Br3NO6S2 |
| Molecular Weight | 544.04 g/mol |
| Exact Mass | 540.75 |
| IUPAC Name | 2-[[2-(tribromomethylsulfonyl)benzoyl]amino]ethanesulfonic acid |
| SMILES | O=C(NCCS(=O)(=O)O)c1ccccc1S(=O)(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C10H10Br3NO6S2/c11-10(12,13)22(19,20)8-4-2-1-3-7(8)9(15)14-5-6-21(16,17)18/h1-4H,5-6H2,(H,14,15)(H,16,17,18) |
| InChIKey | BPUXHMPBXANNGU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.04 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|