C23H23NO3S — CID 24761812
N-(3,3-diphenylpropyl)-2-methylsulfonylbenzamide (PubChem CID 24761812) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-2-methylsulfonylbenzamide.
| Compound Name | N-(3,3-diphenylpropyl)-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 24761812 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-(3,3-diphenylpropyl)-2-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO3S/c1-28(26,27)22-15-9-8-14-21(22)23(25)24-17-16-20(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15,20H,16-17H2,1H3,(H,24,25) |
| InChIKey | IATJKPMSRBTQCX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |