C21H20N2OS — CID 9398159
N-(3,3-diphenylpropyl)-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 9398159) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9398159 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-(3,3-diphenylpropyl)-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)c1ccc[nH]c1=S |
| InChI | InChI=1S/C21H20N2OS/c24-20(19-12-7-14-23-21(19)25)22-15-13-18(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-12,14,18H,13,15H2,(H,22,24)(H,23,25) |
| InChIKey | NZIOAILTCHOTQT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|