C18H22N2O2S — CID 102560447
N-(4-hydroxy-3,3-dimethyl-2-phenylbutyl)-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 102560447) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is N-(4-hydroxy-3,3-dimethyl-2-phenylbutyl)-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-(4-hydroxy-3,3-dimethyl-2-phenylbutyl)-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 102560447 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-(4-hydroxy-3,3-dimethyl-2-phenylbutyl)-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | CC(C)(CO)C(CNC(=O)c1ccc[nH]c1=S)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O2S/c1-18(2,12-21)15(13-7-4-3-5-8-13)11-20-16(22)14-9-6-10-19-17(14)23/h3-10,15,21H,11-12H2,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | UXSYNPHJEZWNLJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|