C18H23N3OS — CID 25482491
N-[(2S)-2-(diethylamino)-2-phenylethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 25482491) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is N-[(2S)-2-(diethylamino)-2-phenylethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[(2S)-2-(diethylamino)-2-phenylethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25482491 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[(2S)-2-(diethylamino)-2-phenylethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | CCN(CC)[C@H](CNC(=O)c1ccc[nH]c1=S)c1ccccc1 |
| InChI | InChI=1S/C18H23N3OS/c1-3-21(4-2)16(14-9-6-5-7-10-14)13-20-17(22)15-11-8-12-19-18(15)23/h5-12,16H,3-4,13H2,1-2H3,(H,19,23)(H,20,22)/t16-/m1/s1 |
| InChIKey | ORPYAJOIXUXNGD-MRXNPFEDSA-N |
| XLogP | 3.56 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|