C8H11N3OS — CID 130634637
N-(2-aminoethyl)-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 130634637) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 130634637 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | N-(2-aminoethyl)-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | NCCNC(=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C8H11N3OS/c9-3-5-10-7(12)6-2-1-4-11-8(6)13/h1-2,4H,3,5,9H2,(H,10,12)(H,11,13) |
| InChIKey | VZVXYCJVPQOHPP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|