C13H18N2O2S — CID 99701691
N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 99701691) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 99701691 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC[C@H]1CCCC[C@@H]1O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C13H18N2O2S/c16-11-6-2-1-4-9(11)8-15-12(17)10-5-3-7-14-13(10)18/h3,5,7,9,11,16H,1-2,4,6,8H2,(H,14,18)(H,15,17)/t9-,11+/m1/s1 |
| InChIKey | LJNGCVXUBJMLFX-KOLCDFICSA-N |
| XLogP | 2.03 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|