C14H16F3NO2 — CID 64910898
3,4,5-trifluoro-N-[(2-hydroxycyclohexyl)methyl]benzamide (PubChem CID 64910898) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[(2-hydroxycyclohexyl)methyl]benzamide.
| Compound Name | 3,4,5-trifluoro-N-[(2-hydroxycyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 64910898 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3,4,5-trifluoro-N-[(2-hydroxycyclohexyl)methyl]benzamide |
| SMILES | O=C(NCC1CCCCC1O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H16F3NO2/c15-10-5-9(6-11(16)13(10)17)14(20)18-7-8-3-1-2-4-12(8)19/h5-6,8,12,19H,1-4,7H2,(H,18,20) |
| InChIKey | FAWJENFIZRTSGH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|