C14H18F2N2O2 — CID 79773461
3-amino-2,6-difluoro-N-[(2-hydroxycyclohexyl)methyl]benzamide (PubChem CID 79773461) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-amino-2,6-difluoro-N-[(2-hydroxycyclohexyl)methyl]benzamide.
| Compound Name | 3-amino-2,6-difluoro-N-[(2-hydroxycyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 79773461 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-amino-2,6-difluoro-N-[(2-hydroxycyclohexyl)methyl]benzamide |
| SMILES | Nc1ccc(F)c(C(=O)NCC2CCCCC2O)c1F |
| InChI | InChI=1S/C14H18F2N2O2/c15-9-5-6-10(17)13(16)12(9)14(20)18-7-8-3-1-2-4-11(8)19/h5-6,8,11,19H,1-4,7,17H2,(H,18,20) |
| InChIKey | SPPHXZTXAAFFQY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|