C15H21F2N3O — CID 79759421
3-amino-N-[2-[cyclopentyl(methyl)amino]ethyl]-2,6-difluorobenzamide (PubChem CID 79759421) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-amino-N-[2-[cyclopentyl(methyl)amino]ethyl]-2,6-difluorobenzamide.
| Compound Name | 3-amino-N-[2-[cyclopentyl(methyl)amino]ethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 79759421 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-amino-N-[2-[cyclopentyl(methyl)amino]ethyl]-2,6-difluorobenzamide |
| SMILES | CN(CCNC(=O)c1c(F)ccc(N)c1F)C1CCCC1 |
| InChI | InChI=1S/C15H21F2N3O/c1-20(10-4-2-3-5-10)9-8-19-15(21)13-11(16)6-7-12(18)14(13)17/h6-7,10H,2-5,8-9,18H2,1H3,(H,19,21) |
| InChIKey | YCAYHNQEIJDJAH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|