C12H17F2N3O — CID 79772967
3-amino-N-[2-[ethyl(methyl)amino]ethyl]-2,6-difluorobenzamide (PubChem CID 79772967) has the molecular formula C12H17F2N3O and a molecular weight of 257.28 g/mol. Its IUPAC name is 3-amino-N-[2-[ethyl(methyl)amino]ethyl]-2,6-difluorobenzamide.
| Compound Name | 3-amino-N-[2-[ethyl(methyl)amino]ethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 79772967 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 3-amino-N-[2-[ethyl(methyl)amino]ethyl]-2,6-difluorobenzamide |
| SMILES | CCN(C)CCNC(=O)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C12H17F2N3O/c1-3-17(2)7-6-16-12(18)10-8(13)4-5-9(15)11(10)14/h4-5H,3,6-7,15H2,1-2H3,(H,16,18) |
| InChIKey | ZEGZNTJWUXHUSG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|