C12H19N3O2 — CID 107075159
4-amino-N-[2-[ethyl(methyl)amino]ethyl]-3-hydroxybenzamide (PubChem CID 107075159) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-amino-N-[2-[ethyl(methyl)amino]ethyl]-3-hydroxybenzamide.
| Compound Name | 4-amino-N-[2-[ethyl(methyl)amino]ethyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 107075159 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-amino-N-[2-[ethyl(methyl)amino]ethyl]-3-hydroxybenzamide |
| SMILES | CCN(C)CCNC(=O)c1ccc(N)c(O)c1 |
| InChI | InChI=1S/C12H19N3O2/c1-3-15(2)7-6-14-12(17)9-4-5-10(13)11(16)8-9/h4-5,8,16H,3,6-7,13H2,1-2H3,(H,14,17) |
| InChIKey | VWVBIMQWVBRDAH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|