C14H21N3O4 — CID 102739374
tert-butyl N-[2-[(4-amino-3-hydroxybenzoyl)amino]ethyl]carbamate (PubChem CID 102739374) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-amino-3-hydroxybenzoyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-amino-3-hydroxybenzoyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 102739374 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | tert-butyl N-[2-[(4-amino-3-hydroxybenzoyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1ccc(N)c(O)c1 |
| InChI | InChI=1S/C14H21N3O4/c1-14(2,3)21-13(20)17-7-6-16-12(19)9-4-5-10(15)11(18)8-9/h4-5,8,18H,6-7,15H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | WOOAURJBIKZWRW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|