C13H20N2O4 — CID 106249241
4-amino-3-hydroxy-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzamide (PubChem CID 106249241) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzamide.
| Compound Name | 4-amino-3-hydroxy-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzamide |
|---|---|
| PubChem CID | 106249241 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-amino-3-hydroxy-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzamide |
| SMILES | COCCC(C)(O)CNC(=O)c1ccc(N)c(O)c1 |
| InChI | InChI=1S/C13H20N2O4/c1-13(18,5-6-19-2)8-15-12(17)9-3-4-10(14)11(16)7-9/h3-4,7,16,18H,5-6,8,14H2,1-2H3,(H,15,17) |
| InChIKey | VPWRFXIMVLZWHL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|