C14H20FNO3 — CID 103712284
3-fluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)-4-methylbenzamide (PubChem CID 103712284) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 3-fluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)-4-methylbenzamide.
| Compound Name | 3-fluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 103712284 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-fluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)-4-methylbenzamide |
| SMILES | COCCC(C)(O)CNC(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C14H20FNO3/c1-10-4-5-11(8-12(10)15)13(17)16-9-14(2,18)6-7-19-3/h4-5,8,18H,6-7,9H2,1-3H3,(H,16,17) |
| InChIKey | LVFYSTNAHPPCOP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |